CAS 1323536-42-0 is the registry number for ((5-(2-Thienyl)isoxazol-3-yl)methyl)amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(5-thiophen-2-yl-1,2-oxazol-3-yl)methanamine;hydrochloride (CAS 1323536-42-0) is a chemical compound with the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. IUPAC name: (5-thiophen-2-yl-1,2-oxazol-3-yl)methanamine;hydrochloride. InChIKey: ZUJAWGBCQNRANH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2OS |
|---|---|
| Molecular weight | 216.69 g/mol |
| IUPAC name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methanamine;hydrochloride |
| InChIKey | ZUJAWGBCQNRANH-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=NO2)CN.Cl |
Computed by PubChem (NCBI)