Products 1820739-64-7
CAS 1820739-64-7 appears in our catalog under these names: 1-((6-Chloropyridin-3-yl)sulfanyl)-N,N-dimethylformamide, 95%, 1-((6-Chloropyridin-3-yl)sulfanyl)-N,N-dimethylformamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
S-[(6-chloro-3-pyridinyl)] N,N-dimethylcarbamothioate (CAS 1820739-64-7) is a chemical compound with the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. IUPAC name: S-[(6-chloro-3-pyridinyl)] N,N-dimethylcarbamothioate. InChIKey: OKPPYJHRTJGXCY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2OS |
|---|---|
| Molecular weight | 216.69 g/mol |
| IUPAC name | S-[(6-chloro-3-pyridinyl)] N,N-dimethylcarbamothioate |
| InChIKey | OKPPYJHRTJGXCY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)SC1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)