Products 36029-56-8

CAS 36029-56-8 is the registry number for Benzoyl imidothiocarbamate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

S-carbamimidoyl benzenecarbothioate;hydrochloride (CAS 36029-56-8) is a chemical compound with the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. IUPAC name: S-carbamimidoyl benzenecarbothioate;hydrochloride. InChIKey: AQLADZQAEAWYAP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClN2OS
Molecular weight216.69 g/mol
IUPAC nameS-carbamimidoyl benzenecarbothioate;hydrochloride
InChIKeyAQLADZQAEAWYAP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)SC(=N)N.Cl

Computed by PubChem (NCBI)