CAS 36029-56-8 is the registry number for Benzoyl imidothiocarbamate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
S-carbamimidoyl benzenecarbothioate;hydrochloride (CAS 36029-56-8) is a chemical compound with the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. IUPAC name: S-carbamimidoyl benzenecarbothioate;hydrochloride. InChIKey: AQLADZQAEAWYAP-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2OS |
|---|---|
| Molecular weight | 216.69 g/mol |
| IUPAC name | S-carbamimidoyl benzenecarbothioate;hydrochloride |
| InChIKey | AQLADZQAEAWYAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)SC(=N)N.Cl |
Computed by PubChem (NCBI)