Products 338740-00-4
CAS 338740-00-4 appears in our catalog under these names: 4-chloro-2-(methylsulfanyl)-5H,7H,8H-pyrano[4,3-d]pyrimidine, 95%, 4-chloro-2-(methylsulfanyl)-5H,7H,8H-pyrano[4,3-d]pyrimidine, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
4-chloro-2-methylsulfanyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidine (CAS 338740-00-4) is a chemical compound with the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. IUPAC name: 4-chloro-2-methylsulfanyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidine. InChIKey: LWMGMZBJNJIAFH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2OS |
|---|---|
| Molecular weight | 216.69 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanyl-7,8-dihydro-5H-pyrano[4,3-d]pyrimidine |
| InChIKey | LWMGMZBJNJIAFH-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(COCC2)C(=N1)Cl |
Computed by PubChem (NCBI)