CAS 1177308-09-6 appears in our catalog under these names: 3-Dimethylaminomethyl-4-methoxy-benzaldehyde hydrochloride, 95%, 3-((Dimethylamino)methyl)-4-methoxybenzaldehyde hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
3-[(dimethylamino)methyl]-4-methoxybenzaldehyde;hydrochloride (CAS 1177308-09-6) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 3-[(dimethylamino)methyl]-4-methoxybenzaldehyde;hydrochloride. InChIKey: JAPSQQRHIZHRHY-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 3-[(dimethylamino)methyl]-4-methoxybenzaldehyde;hydrochloride |
| InChIKey | JAPSQQRHIZHRHY-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=C(C=CC(=C1)C=O)OC.Cl |
Computed by PubChem (NCBI)