Products 1177415-92-7
CAS 1177415-92-7 is the registry number for 6,8-DICHLOROIMIDAZO[1,2-B]PYRIDAZINE-3-CARBOXYLIC ACID, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6,8-dichloroimidazo[1,2-b]pyridazine-3-carboxylic acid (CAS 1177415-92-7) is a chemical compound with the molecular formula C7H3Cl2N3O2 and a molecular weight of 232.02 g/mol. IUPAC name: 6,8-dichloroimidazo[1,2-b]pyridazine-3-carboxylic acid. InChIKey: PSQRBXGMFDMAFC-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O2 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 6,8-dichloroimidazo[1,2-b]pyridazine-3-carboxylic acid |
| InChIKey | PSQRBXGMFDMAFC-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=C(N2N=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)