Products 847145-54-4
CAS 847145-54-4 is the registry number for 2,4-Dichloro-6-methyl-5-nitronicotinonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6-methyl-5-nitropyridine-3-carbonitrile (CAS 847145-54-4) is a chemical compound with the molecular formula C7H3Cl2N3O2 and a molecular weight of 232.02 g/mol. IUPAC name: 2,4-dichloro-6-methyl-5-nitropyridine-3-carbonitrile. InChIKey: SXUYDRHHTIBUBE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O2 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 2,4-dichloro-6-methyl-5-nitropyridine-3-carbonitrile |
| InChIKey | SXUYDRHHTIBUBE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)Cl)C#N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)