CAS 168123-71-5 is the registry number for 6,7-Dichloro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (CAS 168123-71-5) is a chemical compound with the molecular formula C7H3Cl2N3O2 and a molecular weight of 232.02 g/mol. IUPAC name: 6,7-dichloro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione. InChIKey: ALLQCIHKTZLKNG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O2 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 6,7-dichloro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| InChIKey | ALLQCIHKTZLKNG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Cl)Cl)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)