CAS 2482820-14-2 is the registry number for 6,7-Dichloropyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-1H-pyrido[2,3-d]pyrimidine-2,4-dione (CAS 2482820-14-2) is a chemical compound with the molecular formula C7H3Cl2N3O2 and a molecular weight of 232.02 g/mol. IUPAC name: 6,7-dichloro-1H-pyrido[2,3-d]pyrimidine-2,4-dione. InChIKey: IDLLJIITUOJYAR-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O2 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 6,7-dichloro-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| InChIKey | IDLLJIITUOJYAR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Cl)Cl)NC(=O)NC2=O |
Computed by PubChem (NCBI)