CAS 2225147-58-8 is the registry number for 2,7-Dichloro-3-nitroimidazo(1,2-a)pyridine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2,7-dichloro-3-nitroimidazo[1,2-a]pyridine (CAS 2225147-58-8) is a chemical compound with the molecular formula C7H3Cl2N3O2 and a molecular weight of 232.02 g/mol. IUPAC name: 2,7-dichloro-3-nitroimidazo[1,2-a]pyridine. InChIKey: REEGKMMALSUWMI-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O2 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 2,7-dichloro-3-nitroimidazo[1,2-a]pyridine |
| InChIKey | REEGKMMALSUWMI-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=C2[N+](=O)[O-])Cl)C=C1Cl |
Computed by PubChem (NCBI)