CAS 316810-83-0 appears in our catalog under these names: 3,5-Dichloro-7-nitro-1H-indazole, 95+%, 3,5-Dichloro-7-nitro-1H-indazole, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3,5-dichloro-7-nitro-2H-indazole (CAS 316810-83-0) is a chemical compound with the molecular formula C7H3Cl2N3O2 and a molecular weight of 232.02 g/mol. IUPAC name: 3,5-dichloro-7-nitro-2H-indazole. InChIKey: NELXRSVXPWIVOY-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O2 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 3,5-dichloro-7-nitro-2H-indazole |
| InChIKey | NELXRSVXPWIVOY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=NNC(=C21)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)