CAS 2533866-82-7 is the registry number for 4,6-Dichloro-1H-imidazo[4,5-c]pyridine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-1H-imidazo[4,5-c]pyridine-2-carboxylic acid (CAS 2533866-82-7) is a chemical compound with the molecular formula C7H3Cl2N3O2 and a molecular weight of 232.02 g/mol. IUPAC name: 4,6-dichloro-1H-imidazo[4,5-c]pyridine-2-carboxylic acid. InChIKey: BERHCWRYGIRGIG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3O2 |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 4,6-dichloro-1H-imidazo[4,5-c]pyridine-2-carboxylic acid |
| InChIKey | BERHCWRYGIRGIG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(N=C1Cl)Cl)N=C(N2)C(=O)O |
Computed by PubChem (NCBI)