CAS 1180519-29-2 appears in our catalog under these names: 6-(Trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyridin-3-amine, 98%, 6-(Trifluoromethyl)-(1,2,4)triazolo(4,3-a)pyridin-3-amine, 6-(Trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine, 95%, 95%, 6-(Trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine (CAS 1180519-29-2) is a chemical compound with the molecular formula C7H5F3N4 and a molecular weight of 202.14 g/mol. IUPAC name: 6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine. InChIKey: FYYHQALGUZDERU-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4 |
|---|---|
| Molecular weight | 202.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
| InChIKey | FYYHQALGUZDERU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2C=C1C(F)(F)F)N |
Computed by PubChem (NCBI)