Products 1186608-81-0
CAS 1186608-81-0 appears in our catalog under these names: 3-(Trifluoromethyl)-1h-pyrazolo[3,4-b]pyridin-5-amine, 95%, 3-(Trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 100mg, 1g.
3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-5-amine (CAS 1186608-81-0) is a chemical compound with the molecular formula C7H5F3N4 and a molecular weight of 202.14 g/mol. IUPAC name: 3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-5-amine. InChIKey: DSXLEXVXOIBPFB-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4 |
|---|---|
| Molecular weight | 202.14 g/mol |
| IUPAC name | 3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-5-amine |
| InChIKey | DSXLEXVXOIBPFB-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=NNC(=C21)C(F)(F)F)N |
Computed by PubChem (NCBI)