CAS 723286-86-0 appears in our catalog under these names: 5-Methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine, 95%, 5-Methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine, 99%, 99%, 5-Methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine, 99%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
5-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine (CAS 723286-86-0) is a chemical compound with the molecular formula C7H5F3N4 and a molecular weight of 202.14 g/mol. IUPAC name: 5-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine. InChIKey: MBHVCNBINCRYSW-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4 |
|---|---|
| Molecular weight | 202.14 g/mol |
| IUPAC name | 5-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| InChIKey | MBHVCNBINCRYSW-UHFFFAOYSA-N |
| SMILES | CC1=CN=CC2=NN=C(N12)C(F)(F)F |
Computed by PubChem (NCBI)