CAS 1277178-31-0 is the registry number for 6-(Trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine (CAS 1277178-31-0) is a chemical compound with the molecular formula C7H5F3N4 and a molecular weight of 202.14 g/mol. IUPAC name: 6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine. InChIKey: LXEVYXYFNCGKPO-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4 |
|---|---|
| Molecular weight | 202.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
| InChIKey | LXEVYXYFNCGKPO-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NN=CN2C=C1C(F)(F)F)N |
Computed by PubChem (NCBI)