CAS 1356003-25-2 is the registry number for 2-(Trifluoromethyl)pyrazolo[1,5-a]pyrimidin-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-6-amine (CAS 1356003-25-2) is a chemical compound with the molecular formula C7H5F3N4 and a molecular weight of 202.14 g/mol. IUPAC name: 2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-6-amine. InChIKey: CLNBEMAKMIJXBU-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4 |
|---|---|
| Molecular weight | 202.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-6-amine |
| InChIKey | CLNBEMAKMIJXBU-UHFFFAOYSA-N |
| SMILES | C1=C2N=CC(=CN2N=C1C(F)(F)F)N |
Computed by PubChem (NCBI)