CAS 1546447-84-0 appears in our catalog under these names: 2-(Trifluoromethyl)-(1,2,4)triazolo(1,5-a)pyridin-7-amine, 97%, 2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-7-amine, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g.
2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-7-amine (CAS 1546447-84-0) is a chemical compound with the molecular formula C7H5F3N4 and a molecular weight of 202.14 g/mol. IUPAC name: 2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-7-amine. InChIKey: ULFSVBHEKCKZJQ-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4 |
|---|---|
| Molecular weight | 202.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-7-amine |
| InChIKey | ULFSVBHEKCKZJQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)C(F)(F)F)C=C1N |
Computed by PubChem (NCBI)