CAS 1416439-95-6 appears in our catalog under these names: 8-(Trifluoromethyl)-(1,2,4)triazolo(1,5-a)pyridin-2-amine, 98%, 8-(Trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 98%, 98%, 8-(TRIFLUOROMETHYL)-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-2-AMINE, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
8-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1416439-95-6) is a chemical compound with the molecular formula C7H5F3N4 and a molecular weight of 202.14 g/mol. IUPAC name: 8-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: PKBQGDUCEDDCDS-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4 |
|---|---|
| Molecular weight | 202.14 g/mol |
| IUPAC name | 8-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | PKBQGDUCEDDCDS-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)N)C(=C1)C(F)(F)F |
Computed by PubChem (NCBI)