CAS 118055-03-1 appears in our catalog under these names: 2-(Pyrazolo(1,5-a)pyridin-3-yl)acetic acid, 97%, 2-{Pyrazolo(1,5-a)pyridin-3-yl}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
2-pyrazolo[1,5-a]pyridin-3-ylacetic acid (CAS 118055-03-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-pyrazolo[1,5-a]pyridin-3-ylacetic acid. InChIKey: VJVCNAGVXRMLPL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-pyrazolo[1,5-a]pyridin-3-ylacetic acid |
| InChIKey | VJVCNAGVXRMLPL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NN2C=C1)CC(=O)O |
Computed by PubChem (NCBI)