CAS 1181266-63-6 is the registry number for 3-(1,3-Benzoxazol-5-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1,3-benzoxazol-5-yl)propanoic acid (CAS 1181266-63-6) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 3-(1,3-benzoxazol-5-yl)propanoic acid. InChIKey: REBKIXQFIKSODS-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 3-(1,3-benzoxazol-5-yl)propanoic acid |
| InChIKey | REBKIXQFIKSODS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CCC(=O)O)N=CO2 |
Computed by PubChem (NCBI)