Products 1181266-63-6

CAS 1181266-63-6 is the registry number for 3-(1,3-Benzoxazol-5-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(1,3-benzoxazol-5-yl)propanoic acid (CAS 1181266-63-6) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 3-(1,3-benzoxazol-5-yl)propanoic acid. InChIKey: REBKIXQFIKSODS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO3
Molecular weight191.18 g/mol
IUPAC name3-(1,3-benzoxazol-5-yl)propanoic acid
InChIKeyREBKIXQFIKSODS-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1CCC(=O)O)N=CO2

Computed by PubChem (NCBI)