CAS 1181454-72-7 is the registry number for 1-(3,4-Dichlorophenyl)-3-methylbutan-2-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,4-dichlorophenyl)-3-methylbutan-2-one (CAS 1181454-72-7) is a chemical compound with the molecular formula C11H12Cl2O and a molecular weight of 231.11 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-methylbutan-2-one. InChIKey: RYXJXNHUVVERNP-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O |
|---|---|
| Molecular weight | 231.11 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-methylbutan-2-one |
| InChIKey | RYXJXNHUVVERNP-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)