CAS 2921888-60-8 is the registry number for 5-(tert-Butyl)-2,3-dichlorobenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-tert-butyl-2,3-dichlorobenzaldehyde (CAS 2921888-60-8) is a chemical compound with the molecular formula C11H12Cl2O and a molecular weight of 231.11 g/mol. IUPAC name: 5-tert-butyl-2,3-dichlorobenzaldehyde. InChIKey: HGAYQSXUWROVSP-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O |
|---|---|
| Molecular weight | 231.11 g/mol |
| IUPAC name | 5-tert-butyl-2,3-dichlorobenzaldehyde |
| InChIKey | HGAYQSXUWROVSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Cl)Cl)C=O |
Computed by PubChem (NCBI)