CAS 61023-66-3 appears in our catalog under these names: 2',4'–Dichlorovalerophenone, 2',4'-Dichlorovalerophenone, >95.0%(GC), 1-(2,4-Dichlorophenyl)pentan-1-one 98+%, 1-(2,4-Dichlorophenyl)-1-pentanone, 98+%, 98+%. Offered by: GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100g, 25g, 5g.
1-(2,4-dichlorophenyl)pentan-1-one (CAS 61023-66-3) is a chemical compound with the molecular formula C11H12Cl2O and a molecular weight of 231.11 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)pentan-1-one. InChIKey: XVWXSWROOLWNCJ-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O |
|---|---|
| Molecular weight | 231.11 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)pentan-1-one |
| InChIKey | XVWXSWROOLWNCJ-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)