CAS 51631-50-6 appears in our catalog under these names: 3-Methyl-2-(4-chlorophenyl)butyryl chloride, 95%, 2-(4-Chlorophenyl)-3-methylbutanoyl chloride 98%, 3-Methyl-2-(4-chlorophenyl)butyryl chloride, 98%, 98%, 3-METHYL-2-(4-CHLOROPHENYL)BUTYRYL CHLORIDE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 500g.
2-(4-chlorophenyl)-3-methylbutanoyl chloride (CAS 51631-50-6) is a chemical compound with the molecular formula C11H12Cl2O and a molecular weight of 231.11 g/mol. IUPAC name: 2-(4-chlorophenyl)-3-methylbutanoyl chloride. InChIKey: BWPYAVCZZUTOBY-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O |
|---|---|
| Molecular weight | 231.11 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-3-methylbutanoyl chloride |
| InChIKey | BWPYAVCZZUTOBY-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC=C(C=C1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)