CAS 1193390-50-9 is the registry number for 6,8-Bis(chloromethyl)-3,4-dihydro-2H-1-benzopyran, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6,8-bis(chloromethyl)-3,4-dihydro-2H-chromene (CAS 1193390-50-9) is a chemical compound with the molecular formula C11H12Cl2O and a molecular weight of 231.11 g/mol. IUPAC name: 6,8-bis(chloromethyl)-3,4-dihydro-2H-chromene. InChIKey: DFRZTGYWHPDJMA-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O |
|---|---|
| Molecular weight | 231.11 g/mol |
| IUPAC name | 6,8-bis(chloromethyl)-3,4-dihydro-2H-chromene |
| InChIKey | DFRZTGYWHPDJMA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)CCl)CCl)OC1 |
Computed by PubChem (NCBI)