CAS 1247496-38-3 is the registry number for 3,4-Dichloro-α-cyclopropyl-α-methylbenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-cyclopropyl-1-(3,4-dichlorophenyl)ethanol (CAS 1247496-38-3) is a chemical compound with the molecular formula C11H12Cl2O and a molecular weight of 231.11 g/mol. IUPAC name: 1-cyclopropyl-1-(3,4-dichlorophenyl)ethanol. InChIKey: CCRCXNJNLKFNAR-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O |
|---|---|
| Molecular weight | 231.11 g/mol |
| IUPAC name | 1-cyclopropyl-1-(3,4-dichlorophenyl)ethanol |
| InChIKey | CCRCXNJNLKFNAR-UHFFFAOYSA-N |
| SMILES | CC(C1CC1)(C2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)