CAS 1181566-40-4 appears in our catalog under these names: 5-(4-Hydroxyphenyl)nicotinic acid, 97%, 5-(4-Hydroxyphenyl)nicotinic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
5-(4-hydroxyphenyl)pyridine-3-carboxylic acid (CAS 1181566-40-4) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 5-(4-hydroxyphenyl)pyridine-3-carboxylic acid. InChIKey: DRHYGHNDVGOJDZ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 5-(4-hydroxyphenyl)pyridine-3-carboxylic acid |
| InChIKey | DRHYGHNDVGOJDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CN=C2)C(=O)O)O |
Computed by PubChem (NCBI)