Products 1181643-95-7
CAS 1181643-95-7 is the registry number for 6-Cyclopropyl-2-methyl-4-pyrimidinecarboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-cyclopropyl-2-methylpyrimidine-4-carboxylic acid (CAS 1181643-95-7) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 6-cyclopropyl-2-methylpyrimidine-4-carboxylic acid. InChIKey: XMGMUMPYORJQGI-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 6-cyclopropyl-2-methylpyrimidine-4-carboxylic acid |
| InChIKey | XMGMUMPYORJQGI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)C(=O)O)C2CC2 |
Computed by PubChem (NCBI)