Products 1181714-73-7
CAS 1181714-73-7 is the registry number for 3-Methyl-2-oxo-1,2-dihydroquinoline-6-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methyl-2-oxo-1H-quinoline-6-sulfonyl chloride (CAS 1181714-73-7) is a chemical compound with the molecular formula C10H8ClNO3S and a molecular weight of 257.69 g/mol. IUPAC name: 3-methyl-2-oxo-1H-quinoline-6-sulfonyl chloride. InChIKey: PTAXFVRHTAHJDN-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3S |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | 3-methyl-2-oxo-1H-quinoline-6-sulfonyl chloride |
| InChIKey | PTAXFVRHTAHJDN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)S(=O)(=O)Cl)NC1=O |
Computed by PubChem (NCBI)