Products 1181867-71-9
CAS 1181867-71-9 is the registry number for N-(3-Aminophenyl)-5-methyl-1,2-oxazole-4-carboxamide hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(3-aminophenyl)-5-methyl-1,2-oxazole-4-carboxamide;hydrochloride (CAS 1181867-71-9) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: N-(3-aminophenyl)-5-methyl-1,2-oxazole-4-carboxamide;hydrochloride. InChIKey: ONUUOZJMGNGQNN-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | N-(3-aminophenyl)-5-methyl-1,2-oxazole-4-carboxamide;hydrochloride |
| InChIKey | ONUUOZJMGNGQNN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NO1)C(=O)NC2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)