Products 878011-41-7
CAS 878011-41-7 appears in our catalog under these names: 3-Boc-7-chloro-3h-imidazo[4,5-b]pyridine, 98%, 3-Boc-7-chloro-3H-imidazo(4,5-b)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
Tert-butyl 7-chloroimidazo[4,5-b]pyridine-3-carboxylate (CAS 878011-41-7) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: tert-butyl 7-chloroimidazo[4,5-b]pyridine-3-carboxylate. InChIKey: KVKOBEZGRPNKQK-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | tert-butyl 7-chloroimidazo[4,5-b]pyridine-3-carboxylate |
| InChIKey | KVKOBEZGRPNKQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=NC2=C(C=CN=C21)Cl |
Computed by PubChem (NCBI)