CAS 1185132-00-6 is the registry number for 4-Methoxy-3-(1h-1,2,4-triazol-1-ylmethyl)benzaldehyde hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-methoxy-3-(1,2,4-triazol-1-ylmethyl)benzaldehyde;hydrochloride (CAS 1185132-00-6) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: 4-methoxy-3-(1,2,4-triazol-1-ylmethyl)benzaldehyde;hydrochloride. InChIKey: CSUVEOYHXFDRRB-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 4-methoxy-3-(1,2,4-triazol-1-ylmethyl)benzaldehyde;hydrochloride |
| InChIKey | CSUVEOYHXFDRRB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C=O)CN2C=NC=N2.Cl |
Computed by PubChem (NCBI)