CAS 956076-74-7 is the registry number for 2-Chloro-N-[(5-cyano-2,4-dimethyl-6-oxo-1,6-dihydropyridin-3-yl)methyl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-N-[(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)methyl]acetamide (CAS 956076-74-7) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: 2-chloro-N-[(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)methyl]acetamide. InChIKey: UNUKZYVFIAMXOQ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 2-chloro-N-[(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)methyl]acetamide |
| InChIKey | UNUKZYVFIAMXOQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=C1CNC(=O)CCl)C)C#N |
Computed by PubChem (NCBI)