Products 261787-78-4
CAS 261787-78-4 appears in our catalog under these names: 3-(1,3-dioxo-2,3-dihydro-1h-isoindol-2-yl)propanimidamide hydrochloride, 95%, 3-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)propanimidamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-(1,3-dioxoisoindol-2-yl)propanimidamide;hydrochloride (CAS 261787-78-4) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)propanimidamide;hydrochloride. InChIKey: ZLLFSWNFEMJNKW-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)propanimidamide;hydrochloride |
| InChIKey | ZLLFSWNFEMJNKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC(=N)N.Cl |
Computed by PubChem (NCBI)