Products 310442-94-5

CAS 310442-94-5 is the registry number for Ethyl 4-chloro-5-ethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-chloro-5-ethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (CAS 310442-94-5) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: ethyl 4-chloro-5-ethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate. InChIKey: QJCOYJRUMINHLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClN3O2
Molecular weight253.68 g/mol
IUPAC nameethyl 4-chloro-5-ethylpyrrolo[2,1-f][1,2,4]triazine-6-carboxylate
InChIKeyQJCOYJRUMINHLZ-UHFFFAOYSA-N
SMILESCCC1=C2C(=NC=NN2C=C1C(=O)OCC)Cl

Computed by PubChem (NCBI)