CAS 1393648-54-8 appears in our catalog under these names: 2-Chloro-7h-pyrrolo[2,3-d]pyrimidine-7-carboxylic acid 1,1-dimethylethyl ester, 95%, 2-Chloro-7H-pyrrolo(2,3-d)pyrimidine-7-carboxylic acid 1,1-dimethylethyl ester, 97%, 2-Chloro-7H-pyrrolo[2,3-d]pyrimidine-7-carboxylic acid 1,1-dimethylethyl ester, 97%, 97%, 2-CHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-7-CARBOXYLIC ACID 1,1-DIMETHYLETHYL ESTER, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg, 500mg.
Tert-butyl 2-chloropyrrolo[2,3-d]pyrimidine-7-carboxylate (CAS 1393648-54-8) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: tert-butyl 2-chloropyrrolo[2,3-d]pyrimidine-7-carboxylate. InChIKey: MQYAJRKBAUVWGV-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | tert-butyl 2-chloropyrrolo[2,3-d]pyrimidine-7-carboxylate |
| InChIKey | MQYAJRKBAUVWGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=CN=C(N=C21)Cl |
Computed by PubChem (NCBI)