Products 118204-64-1
CAS 118204-64-1 appears in our catalog under these names: 4H-1-Benzopyran-4-one, 2,3-dihydro-3,5,7-trihydroxy-3-[(4-methoxyphenyl)methyl, ≥98%, ≥98%, (R)-Eucomol. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg.
(3R)-3,5,7-trihydroxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-one (CAS 118204-64-1) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: (3R)-3,5,7-trihydroxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-one. InChIKey: BLSFQQNRFOVLGQ-QGZVFWFLSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | (3R)-3,5,7-trihydroxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-one |
| InChIKey | BLSFQQNRFOVLGQ-QGZVFWFLSA-N |
| SMILES | COC1=CC=C(C=C1)C[C@]2(COC3=CC(=CC(=C3C2=O)O)O)O |
Computed by PubChem (NCBI)