Products 17934-12-2
CAS 17934-12-2 appears in our catalog under these names: Eucomol, 98%, (S)-2,3-Dihydro-3,5,7-trihydroxy-3-[(4-methoxyphenyl)methyl]-4H-1-benzopyran-4-one, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 1 mg, 5mg, 10mg, 20mg, 50mg.
(3S)-3,5,7-trihydroxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-one (CAS 17934-12-2) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: (3S)-3,5,7-trihydroxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-one. InChIKey: BLSFQQNRFOVLGQ-KRWDZBQOSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | (3S)-3,5,7-trihydroxy-3-[(4-methoxyphenyl)methyl]-2H-chromen-4-one |
| InChIKey | BLSFQQNRFOVLGQ-KRWDZBQOSA-N |
| SMILES | COC1=CC=C(C=C1)C[C@@]2(COC3=CC(=CC(=C3C2=O)O)O)O |
Computed by PubChem (NCBI)