CAS 1183482-41-8 appears in our catalog under these names: 4-Fluoro-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline, 95%, 4-Fluoro-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-fluoro-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline (CAS 1183482-41-8) is a chemical compound with the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. IUPAC name: 4-fluoro-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline. InChIKey: JMIPOVMFTGTENX-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3O |
|---|---|
| Molecular weight | 193.18 g/mol |
| IUPAC name | 4-fluoro-2-(5-methyl-1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | JMIPOVMFTGTENX-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=C(C=CC(=C2)F)N |
Computed by PubChem (NCBI)