CAS 1184202-70-7 is the registry number for 2-(2,2-Difluoroethoxy)benzaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,2-difluoroethoxy)benzaldehyde (CAS 1184202-70-7) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 2-(2,2-difluoroethoxy)benzaldehyde. InChIKey: PGLAIFNZARLDOQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 2-(2,2-difluoroethoxy)benzaldehyde |
| InChIKey | PGLAIFNZARLDOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)OCC(F)F |
Computed by PubChem (NCBI)