CAS 1185238-76-9 is the registry number for 4-Hydroxy-3-methoxy-d3-benzaldehyde O-Methyloxime. Offered by: TRC. Available pack sizes: 50mg, 5mg.
4-(methoxyiminomethyl)-2-(trideuteriomethoxy)phenol (CAS 1185238-76-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 184.21 g/mol. IUPAC name: 4-(methoxyiminomethyl)-2-(trideuteriomethoxy)phenol. InChIKey: TWLUCZWNLUUHJT-FIBGUPNXSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 184.21 g/mol |
| IUPAC name | 4-(methoxyiminomethyl)-2-(trideuteriomethoxy)phenol |
| InChIKey | TWLUCZWNLUUHJT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C=NOC)O |
Computed by PubChem (NCBI)