Products 1185245-82-2
CAS 1185245-82-2 appears in our catalog under these names: Caffeic Acid-13C3, >95% (HPLC), Caffeic Acid-13C3, Caffeic Acid–13C3, Caffeic acid-13C3, 98.76%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
(E)-3-(3,4-dihydroxyphenyl)(1,2,3-13C3)prop-2-enoic acid (CAS 1185245-82-2) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 183.14 g/mol. IUPAC name: (E)-3-(3,4-dihydroxyphenyl)(1,2,3-13C3)prop-2-enoic acid. InChIKey: QAIPRVGONGVQAS-JDWYZSDHSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 183.14 g/mol |
| IUPAC name | (E)-3-(3,4-dihydroxyphenyl)(1,2,3-13C3)prop-2-enoic acid |
| InChIKey | QAIPRVGONGVQAS-JDWYZSDHSA-N |
| SMILES | C1=CC(=C(C=C1/[13CH]=[13CH]/[13C](=O)O)O)O |
Computed by PubChem (NCBI)