CAS 1185293-09-7 is the registry number for (3-(1H-Pyrazol-1-yl)phenyl)aminedihydrochloride. Offered by: Biosynth. Available pack sizes: 5g.
3-pyrazol-1-ylaniline;dihydrochloride (CAS 1185293-09-7) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: 3-pyrazol-1-ylaniline;dihydrochloride. InChIKey: XYZDLDUZQMWORN-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | 3-pyrazol-1-ylaniline;dihydrochloride |
| InChIKey | XYZDLDUZQMWORN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=CC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)