CAS 1803582-46-8 appears in our catalog under these names: (5-Chloro-1-methyl-1h-1,3-benzodiazol-2-yl)methanamine hydrochloride, 95%, ((5-Chloro-1-methyl-1H-benzimidazol-2-yl)methyl)amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 1000mg, 500mg, 2000mg, 5000mg.
(5-chloro-1-methylbenzimidazol-2-yl)methanamine;hydrochloride (CAS 1803582-46-8) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: (5-chloro-1-methylbenzimidazol-2-yl)methanamine;hydrochloride. InChIKey: KSEIWURUIJLWSZ-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | (5-chloro-1-methylbenzimidazol-2-yl)methanamine;hydrochloride |
| InChIKey | KSEIWURUIJLWSZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)N=C1CN.Cl |
Computed by PubChem (NCBI)