CAS 1989672-45-8 is the registry number for Isoquinoline-1,4-diamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 250mg, 5g.
Isoquinoline-1,4-diamine;dihydrochloride (CAS 1989672-45-8) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: isoquinoline-1,4-diamine;dihydrochloride. InChIKey: XCCJTGQMPCZEFG-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | isoquinoline-1,4-diamine;dihydrochloride |
| InChIKey | XCCJTGQMPCZEFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2N)N.Cl.Cl |
Computed by PubChem (NCBI)