CAS 1258650-47-3 appears in our catalog under these names: 3-(1H-Imidazol-2-yl)aniline dihydrochloride, 3-(1H-Imidazol-2-yl)aniline dihydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 5g, 250mg, 100mg, 1g.
3-(1H-imidazol-2-yl)aniline;dihydrochloride (CAS 1258650-47-3) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: 3-(1H-imidazol-2-yl)aniline;dihydrochloride. InChIKey: XENSRULSKQVWTD-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | 3-(1H-imidazol-2-yl)aniline;dihydrochloride |
| InChIKey | XENSRULSKQVWTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NC=CN2.Cl.Cl |
Computed by PubChem (NCBI)