CAS 91004-60-3 appears in our catalog under these names: 5-Hydrazinoquinoline dihydrochloride, 95%, 5-Hydrazinylquinoline dihydrochloride, 98%, 5-Hydrazinoquinoline dihydrochloride, 5-hydrazinylquinoline dihydrochloride, 95%, 95%, 1-(QUINOLIN-5-YL)HYDRAZINE 2HCL, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Quinolin-5-ylhydrazine;dihydrochloride (CAS 91004-60-3) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: quinolin-5-ylhydrazine;dihydrochloride. InChIKey: HFMMXNQSQIRKHD-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | quinolin-5-ylhydrazine;dihydrochloride |
| InChIKey | HFMMXNQSQIRKHD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=N2)C(=C1)NN.Cl.Cl |
Computed by PubChem (NCBI)