CAS 51746-93-1 appears in our catalog under these names: [3-(1H-Imidazol-5-yl)phenyl]amine dihydrochloride hydrate, 95%, 3-(1H-Imidazol-4-yl)aniline dihydrochloride, 95%, 3-(1H-Imidazol-4-yl)aniline dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 10g, 1g, 5g.
3-(1H-imidazol-5-yl)aniline;dihydrochloride (CAS 51746-93-1) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: 3-(1H-imidazol-5-yl)aniline;dihydrochloride. InChIKey: TZYNZVSLLZLKHN-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | 3-(1H-imidazol-5-yl)aniline;dihydrochloride |
| InChIKey | TZYNZVSLLZLKHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CN=CN2.Cl.Cl |
Computed by PubChem (NCBI)