Products 2097800-60-5
CAS 2097800-60-5 appears in our catalog under these names: 2-(1-Aminoethyl)-5-chlorobenzimidazole hydrochloride, 95%, 2-(1-Aminoethyl)-5-chlorobenzimidazole Hydrochloride, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-(6-chloro-1H-benzimidazol-2-yl)ethanamine;hydrochloride (CAS 2097800-60-5) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: 1-(6-chloro-1H-benzimidazol-2-yl)ethanamine;hydrochloride. InChIKey: ZRHZPBLSTXZCET-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | 1-(6-chloro-1H-benzimidazol-2-yl)ethanamine;hydrochloride |
| InChIKey | ZRHZPBLSTXZCET-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(N1)C=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)